C14H15F2N3OS2 — CID 42805505
N-[5-[(2,6-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 42805505) has the molecular formula C14H15F2N3OS2 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[5-[(2,6-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(2,6-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42805505 |
| Molecular Formula | C14H15F2N3OS2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-[5-[(2,6-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nnc(SCc2c(F)cccc2F)s1 |
| InChI | InChI=1S/C14H15F2N3OS2/c1-14(2,3)11(20)17-12-18-19-13(22-12)21-7-8-9(15)5-4-6-10(8)16/h4-6H,7H2,1-3H3,(H,17,18,20) |
| InChIKey | CUJKXYUKVUHHSU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|