C28H23FN4O2 — CID 42809565
N-(3-fluorophenyl)-3-[furan-2-ylmethyl-(2-phenylquinazolin-4-yl)amino]propanamide (PubChem CID 42809565) has the molecular formula C28H23FN4O2 and a molecular weight of 466.52 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[furan-2-ylmethyl-(2-phenylquinazolin-4-yl)amino]propanamide.
| Compound Name | N-(3-fluorophenyl)-3-[furan-2-ylmethyl-(2-phenylquinazolin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 42809565 |
| Molecular Formula | C28H23FN4O2 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-(3-fluorophenyl)-3-[furan-2-ylmethyl-(2-phenylquinazolin-4-yl)amino]propanamide |
| SMILES | O=C(CCN(Cc1ccco1)c1nc(-c2ccccc2)nc2ccccc12)Nc1cccc(F)c1 |
| InChI | InChI=1S/C28H23FN4O2/c29-21-10-6-11-22(18-21)30-26(34)15-16-33(19-23-12-7-17-35-23)28-24-13-4-5-14-25(24)31-27(32-28)20-8-2-1-3-9-20/h1-14,17-18H,15-16,19H2,(H,30,34) |
| InChIKey | NZZYHRJZVOLVNX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |