C24H23FN4O2S — CID 42809643
N-(3-fluorophenyl)-3-[2-methoxyethyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide (PubChem CID 42809643) has the molecular formula C24H23FN4O2S and a molecular weight of 450.54 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[2-methoxyethyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide.
| Compound Name | N-(3-fluorophenyl)-3-[2-methoxyethyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 42809643 |
| Molecular Formula | C24H23FN4O2S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-(3-fluorophenyl)-3-[2-methoxyethyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide |
| SMILES | COCCN(CCC(=O)Nc1cccc(F)c1)c1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C24H23FN4O2S/c1-31-14-13-29(12-11-22(30)26-18-7-4-6-17(25)16-18)24-19-8-2-3-9-20(19)27-23(28-24)21-10-5-15-32-21/h2-10,15-16H,11-14H2,1H3,(H,26,30) |
| InChIKey | CVVHUFBMVGMJCP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |