C26H28N4OS — CID 93300017
N-[(1R)-1-phenylethyl]-3-[propyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide (PubChem CID 93300017) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-3-[propyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide.
| Compound Name | N-[(1R)-1-phenylethyl]-3-[propyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 93300017 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-3-[propyl-(2-thiophen-2-ylquinazolin-4-yl)amino]propanamide |
| SMILES | CCCN(CCC(=O)N[C@H](C)c1ccccc1)c1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H28N4OS/c1-3-16-30(17-15-24(31)27-19(2)20-10-5-4-6-11-20)26-21-12-7-8-13-22(21)28-25(29-26)23-14-9-18-32-23/h4-14,18-19H,3,15-17H2,1-2H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | WFXYRBKUEZKKKR-LJQANCHMSA-N |
| XLogP | 5.84 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |