C24H29ClN4O — CID 93140373
N-[(2R)-butan-2-yl]-3-[[2-(2-chlorophenyl)quinazolin-4-yl]-propylamino]propanamide (PubChem CID 93140373) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3-[[2-(2-chlorophenyl)quinazolin-4-yl]-propylamino]propanamide.
| Compound Name | N-[(2R)-butan-2-yl]-3-[[2-(2-chlorophenyl)quinazolin-4-yl]-propylamino]propanamide |
|---|---|
| PubChem CID | 93140373 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3-[[2-(2-chlorophenyl)quinazolin-4-yl]-propylamino]propanamide |
| SMILES | CCCN(CCC(=O)N[C@H](C)CC)c1nc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C24H29ClN4O/c1-4-15-29(16-14-22(30)26-17(3)5-2)24-19-11-7-9-13-21(19)27-23(28-24)18-10-6-8-12-20(18)25/h6-13,17H,4-5,14-16H2,1-3H3,(H,26,30)/t17-/m1/s1 |
| InChIKey | DZONRPQIGAEGLW-QGZVFWFLSA-N |
| XLogP | 5.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |