C24H29BrN4O2 — CID 83281449
3-[[2-(3-bromophenyl)quinazolin-4-yl]-(2-methoxyethyl)amino]-N-butan-2-ylpropanamide (PubChem CID 83281449) has the molecular formula C24H29BrN4O2 and a molecular weight of 485.43 g/mol. Its IUPAC name is 3-[[2-(3-bromophenyl)quinazolin-4-yl]-(2-methoxyethyl)amino]-N-butan-2-ylpropanamide.
| Compound Name | 3-[[2-(3-bromophenyl)quinazolin-4-yl]-(2-methoxyethyl)amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 83281449 |
| Molecular Formula | C24H29BrN4O2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-[[2-(3-bromophenyl)quinazolin-4-yl]-(2-methoxyethyl)amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)CCN(CCOC)c1nc(-c2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H29BrN4O2/c1-4-17(2)26-22(30)12-13-29(14-15-31-3)24-20-10-5-6-11-21(20)27-23(28-24)18-8-7-9-19(25)16-18/h5-11,16-17H,4,12-15H2,1-3H3,(H,26,30) |
| InChIKey | DUWZYOWYWVBTIB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |