C33H32N4O2 — CID 24718265
3-[benzyl-[2-(4-methoxyphenyl)quinazolin-4-yl]amino]-N-(1-phenylethyl)propanamide (PubChem CID 24718265) has the molecular formula C33H32N4O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3-[benzyl-[2-(4-methoxyphenyl)quinazolin-4-yl]amino]-N-(1-phenylethyl)propanamide.
| Compound Name | 3-[benzyl-[2-(4-methoxyphenyl)quinazolin-4-yl]amino]-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 24718265 |
| Molecular Formula | C33H32N4O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-[benzyl-[2-(4-methoxyphenyl)quinazolin-4-yl]amino]-N-(1-phenylethyl)propanamide |
| SMILES | COc1ccc(-c2nc(N(CCC(=O)NC(C)c3ccccc3)Cc3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H32N4O2/c1-24(26-13-7-4-8-14-26)34-31(38)21-22-37(23-25-11-5-3-6-12-25)33-29-15-9-10-16-30(29)35-32(36-33)27-17-19-28(39-2)20-18-27/h3-20,24H,21-23H2,1-2H3,(H,34,38) |
| InChIKey | JTHUYVMAGBHXLQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |