C26H36N4O3 — CID 42818972
2-[4-(2,4-dimethylphenyl)-2,5-dioxo-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-ethyl-N,4-dimethylpentanamide (PubChem CID 42818972) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)-2,5-dioxo-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-ethyl-N,4-dimethylpentanamide.
| Compound Name | 2-[4-(2,4-dimethylphenyl)-2,5-dioxo-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-ethyl-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 42818972 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)-2,5-dioxo-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-ethyl-N,4-dimethylpentanamide |
| SMILES | C=CCN1C(=O)NC(c2ccc(C)cc2C)C2=C1CN(C(CC(C)C)C(=O)N(C)CC)C2=O |
| InChI | InChI=1S/C26H36N4O3/c1-8-12-29-21-15-30(20(13-16(3)4)24(31)28(7)9-2)25(32)22(21)23(27-26(29)33)19-11-10-17(5)14-18(19)6/h8,10-11,14,16,20,23H,1,9,12-13,15H2,2-7H3,(H,27,33) |
| InChIKey | LFOPXDOAXIJRHB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|