C24H34N4O3 — CID 93134768
(2R)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N,N,4-trimethylpentanamide (PubChem CID 93134768) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2R)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N,N,4-trimethylpentanamide.
| Compound Name | (2R)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 93134768 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (2R)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N,N,4-trimethylpentanamide |
| SMILES | CCN1C(=O)N[C@H](c2ccc(C)cc2C)C2=C1CN([C@H](CC(C)C)C(=O)N(C)C)C2=O |
| InChI | InChI=1S/C24H34N4O3/c1-8-27-19-13-28(18(11-14(2)3)22(29)26(6)7)23(30)20(19)21(25-24(27)31)17-10-9-15(4)12-16(17)5/h9-10,12,14,18,21H,8,11,13H2,1-7H3,(H,25,31)/t18-,21-/m1/s1 |
| InChIKey | DFHMGYHHBCGGJO-WIYYLYMNSA-N |
| XLogP | 2.99 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |