C32H35N5O3 — CID 98404428
(2R)-2-[(4S)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 98404428) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is (2R)-2-[(4S)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | (2R)-2-[(4S)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 98404428 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (2R)-2-[(4S)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CCN1C(=O)N[C@@H](c2ccc(C)cc2C)C2=C1CN([C@H](Cc1ccccc1)C(=O)NCCc1ccccn1)C2=O |
| InChI | InChI=1S/C32H35N5O3/c1-4-36-27-20-37(31(39)28(27)29(35-32(36)40)25-14-13-21(2)18-22(25)3)26(19-23-10-6-5-7-11-23)30(38)34-17-15-24-12-8-9-16-33-24/h5-14,16,18,26,29H,4,15,17,19-20H2,1-3H3,(H,34,38)(H,35,40)/t26-,29+/m1/s1 |
| InChIKey | NXLQUKQACJGDEB-UHSQPCAPSA-N |
| XLogP | 3.85 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |