C29H28N6O5 — CID 42818681
2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 42818681) has the molecular formula C29H28N6O5 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42818681 |
| Molecular Formula | C29H28N6O5 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenyl-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CCN1C(=O)NC(c2cccc([N+](=O)[O-])c2)C2=C1CN(C(Cc1ccccc1)C(=O)NCc1ccccn1)C2=O |
| InChI | InChI=1S/C29H28N6O5/c1-2-33-24-18-34(28(37)25(24)26(32-29(33)38)20-11-8-13-22(16-20)35(39)40)23(15-19-9-4-3-5-10-19)27(36)31-17-21-12-6-7-14-30-21/h3-14,16,23,26H,2,15,17-18H2,1H3,(H,31,36)(H,32,38) |
| InChIKey | GNJCMGSXMQDUFF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|