C20H25N5O5 — CID 83280069
2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(2-methylpropyl)acetamide (PubChem CID 83280069) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 83280069 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[1-ethyl-4-(3-nitrophenyl)-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CCN1C(=O)NC(c2cccc([N+](=O)[O-])c2)C2=C1CN(CC(=O)NCC(C)C)C2=O |
| InChI | InChI=1S/C20H25N5O5/c1-4-24-15-10-23(11-16(26)21-9-12(2)3)19(27)17(15)18(22-20(24)28)13-6-5-7-14(8-13)25(29)30/h5-8,12,18H,4,9-11H2,1-3H3,(H,21,26)(H,22,28) |
| InChIKey | RWHOBEUVBPHEOV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|