C33H36N4O3 — CID 98259996
(2S)-N-(3,4-dimethylphenyl)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenylpropanamide (PubChem CID 98259996) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is (2S)-N-(3,4-dimethylphenyl)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(3,4-dimethylphenyl)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 98259996 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (2S)-N-(3,4-dimethylphenyl)-2-[(4R)-4-(2,4-dimethylphenyl)-1-ethyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-3-phenylpropanamide |
| SMILES | CCN1C(=O)N[C@H](c2ccc(C)cc2C)C2=C1CN([C@@H](Cc1ccccc1)C(=O)Nc1ccc(C)c(C)c1)C2=O |
| InChI | InChI=1S/C33H36N4O3/c1-6-36-28-19-37(32(39)29(28)30(35-33(36)40)26-15-12-20(2)16-23(26)5)27(18-24-10-8-7-9-11-24)31(38)34-25-14-13-21(3)22(4)17-25/h7-17,27,30H,6,18-19H2,1-5H3,(H,34,38)(H,35,40)/t27-,30+/m0/s1 |
| InChIKey | BSWNOOXYXFVFTM-BHBYDHKZSA-N |
| XLogP | 5.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |