C21H21F2N3O2 — CID 42819195
2-fluoro-N-[[1-[(2-fluorophenyl)methyl]imidazol-2-yl]methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 42819195) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-fluoro-N-[[1-[(2-fluorophenyl)methyl]imidazol-2-yl]methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-fluoro-N-[[1-[(2-fluorophenyl)methyl]imidazol-2-yl]methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42819195 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-fluoro-N-[[1-[(2-fluorophenyl)methyl]imidazol-2-yl]methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1nccn1Cc1ccccc1F)C(=O)c1ccccc1F |
| InChI | InChI=1S/C21H21F2N3O2/c1-28-13-12-26(21(27)17-7-3-5-9-19(17)23)15-20-24-10-11-25(20)14-16-6-2-4-8-18(16)22/h2-11H,12-15H2,1H3 |
| InChIKey | IKNVZQMIJMABBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |