C20H19F2N3O — CID 42819344
N-ethyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]benzamide (PubChem CID 42819344) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]benzamide.
| Compound Name | N-ethyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42819344 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-ethyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]benzamide |
| SMILES | CCN(Cc1nccn1Cc1ccc(F)cc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F2N3O/c1-2-24(20(26)16-5-9-18(22)10-6-16)14-19-23-11-12-25(19)13-15-3-7-17(21)8-4-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | KDPUGMRCYLELPJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |