C19H18FN3OS — CID 42819347
N-cyclopropyl-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 42819347) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is N-cyclopropyl-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-cyclopropyl-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42819347 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-cyclopropyl-N-[[1-[(4-fluorophenyl)methyl]imidazol-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(Cc1nccn1Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C19H18FN3OS/c20-15-5-3-14(4-6-15)12-22-10-9-21-18(22)13-23(16-7-8-16)19(24)17-2-1-11-25-17/h1-6,9-11,16H,7-8,12-13H2 |
| InChIKey | MVTREZYYGPHFRZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |