C20H21N3O3 — CID 42819878
N-[[1-[(3-methoxyphenyl)methyl]imidazol-2-yl]methyl]-N-prop-2-enylfuran-2-carboxamide (PubChem CID 42819878) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[[1-[(3-methoxyphenyl)methyl]imidazol-2-yl]methyl]-N-prop-2-enylfuran-2-carboxamide.
| Compound Name | N-[[1-[(3-methoxyphenyl)methyl]imidazol-2-yl]methyl]-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42819878 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[[1-[(3-methoxyphenyl)methyl]imidazol-2-yl]methyl]-N-prop-2-enylfuran-2-carboxamide |
| SMILES | C=CCN(Cc1nccn1Cc1cccc(OC)c1)C(=O)c1ccco1 |
| InChI | InChI=1S/C20H21N3O3/c1-3-10-23(20(24)18-8-5-12-26-18)15-19-21-9-11-22(19)14-16-6-4-7-17(13-16)25-2/h3-9,11-13H,1,10,14-15H2,2H3 |
| InChIKey | QWRPUMFMDAPJIN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|