C19H25N3O — CID 42820297
(1-benzyl-3,5-diethylpyrazol-4-yl)-pyrrolidin-1-ylmethanone (PubChem CID 42820297) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (1-benzyl-3,5-diethylpyrazol-4-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (1-benzyl-3,5-diethylpyrazol-4-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42820297 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (1-benzyl-3,5-diethylpyrazol-4-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CCc1nn(Cc2ccccc2)c(CC)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C19H25N3O/c1-3-16-18(19(23)21-12-8-9-13-21)17(4-2)22(20-16)14-15-10-6-5-7-11-15/h5-7,10-11H,3-4,8-9,12-14H2,1-2H3 |
| InChIKey | GVRSSGDIICGMTC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |