C17H22ClN3O — CID 146094539
N-[(1-benzyl-3,5-diethylpyrazol-4-yl)methyl]-2-chloroacetamide (PubChem CID 146094539) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-diethylpyrazol-4-yl)methyl]-2-chloroacetamide.
| Compound Name | N-[(1-benzyl-3,5-diethylpyrazol-4-yl)methyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 146094539 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[(1-benzyl-3,5-diethylpyrazol-4-yl)methyl]-2-chloroacetamide |
| SMILES | CCc1nn(Cc2ccccc2)c(CC)c1CNC(=O)CCl |
| InChI | InChI=1S/C17H22ClN3O/c1-3-15-14(11-19-17(22)10-18)16(4-2)21(20-15)12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,19,22) |
| InChIKey | SPRASKHIXCLCMF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|