C21H21FN4O — CID 42820483
3-cyclopropyl-5-ethyl-1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrazole-4-carboxamide (PubChem CID 42820483) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-cyclopropyl-5-ethyl-1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 3-cyclopropyl-5-ethyl-1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42820483 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 3-cyclopropyl-5-ethyl-1-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCc2cccnc2)c(C2CC2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN4O/c1-2-18-19(21(27)24-13-14-4-3-11-23-12-14)20(15-5-6-15)25-26(18)17-9-7-16(22)8-10-17/h3-4,7-12,15H,2,5-6,13H2,1H3,(H,24,27) |
| InChIKey | IOGMQKAXJHXFKL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |