C21H25FN2O5S — CID 42822168
ethyl 4-[2-[(4-fluorophenyl)sulfonyl-prop-2-enylamino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42822168) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 4-[2-[(4-fluorophenyl)sulfonyl-prop-2-enylamino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[(4-fluorophenyl)sulfonyl-prop-2-enylamino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42822168 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl 4-[2-[(4-fluorophenyl)sulfonyl-prop-2-enylamino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | C=CCN(CC(=O)c1c(C)c(C(=O)OCC)n(C)c1C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-6-12-24(30(27,28)17-10-8-16(22)9-11-17)13-18(25)19-14(3)20(21(26)29-7-2)23(5)15(19)4/h6,8-11H,1,7,12-13H2,2-5H3 |
| InChIKey | ODBVDVBGANNNRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|