C16H24N2O5S — CID 42823191
methyl 4-[2-[ethylsulfonyl(prop-2-enyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42823191) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is methyl 4-[2-[ethylsulfonyl(prop-2-enyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[ethylsulfonyl(prop-2-enyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42823191 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 4-[2-[ethylsulfonyl(prop-2-enyl)amino]acetyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | C=CCN(CC(=O)c1c(C)c(C(=O)OC)n(C)c1C)S(=O)(=O)CC |
| InChI | InChI=1S/C16H24N2O5S/c1-7-9-18(24(21,22)8-2)10-13(19)14-11(3)15(16(20)23-6)17(5)12(14)4/h7H,1,8-10H2,2-6H3 |
| InChIKey | IZLLZIWBZQMVGE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|