C23H29N5O3 — CID 42825359
N-[1-(3,4-dimethoxyphenyl)-4-phenylimidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide (PubChem CID 42825359) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)-4-phenylimidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)-4-phenylimidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 42825359 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)-4-phenylimidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide |
| SMILES | COc1ccc(-n2cc(-c3ccccc3)nc2NC(=O)CNCCN(C)C)cc1OC |
| InChI | InChI=1S/C23H29N5O3/c1-27(2)13-12-24-15-22(29)26-23-25-19(17-8-6-5-7-9-17)16-28(23)18-10-11-20(30-3)21(14-18)31-4/h5-11,14,16,24H,12-13,15H2,1-4H3,(H,25,26,29) |
| InChIKey | LUTJSLNBBGFMPD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|