C23H28ClN5O3 — CID 42825362
N-[4-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)imidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide (PubChem CID 42825362) has the molecular formula C23H28ClN5O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)imidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)imidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 42825362 |
| Molecular Formula | C23H28ClN5O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)imidazol-2-yl]-2-[2-(dimethylamino)ethylamino]acetamide |
| SMILES | COc1ccc(-n2cc(-c3ccc(Cl)cc3)nc2NC(=O)CNCCN(C)C)cc1OC |
| InChI | InChI=1S/C23H28ClN5O3/c1-28(2)12-11-25-14-22(30)27-23-26-19(16-5-7-17(24)8-6-16)15-29(23)18-9-10-20(31-3)21(13-18)32-4/h5-10,13,15,25H,11-12,14H2,1-4H3,(H,26,27,30) |
| InChIKey | IBZWOGNCERGILM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|