C28H28FN3O4S — CID 42825484
N-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 42825484) has the molecular formula C28H28FN3O4S and a molecular weight of 521.61 g/mol. Its IUPAC name is N-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42825484 |
| Molecular Formula | C28H28FN3O4S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1cnc(S(=O)(=O)Cc2ccccc2)n1Cc1ccccc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C28H28FN3O4S/c1-36-16-15-31(27(33)24-13-8-14-25(29)17-24)20-26-18-30-28(32(26)19-22-9-4-2-5-10-22)37(34,35)21-23-11-6-3-7-12-23/h2-14,17-18H,15-16,19-21H2,1H3 |
| InChIKey | MVZUBRNVTYWHFS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |