C29H28FN3O3S — CID 42825509
N-[[3-benzyl-2-[(2-methylphenyl)methylsulfonyl]imidazol-4-yl]methyl]-3-fluoro-N-prop-2-enylbenzamide (PubChem CID 42825509) has the molecular formula C29H28FN3O3S and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[[3-benzyl-2-[(2-methylphenyl)methylsulfonyl]imidazol-4-yl]methyl]-3-fluoro-N-prop-2-enylbenzamide.
| Compound Name | N-[[3-benzyl-2-[(2-methylphenyl)methylsulfonyl]imidazol-4-yl]methyl]-3-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42825509 |
| Molecular Formula | C29H28FN3O3S |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[[3-benzyl-2-[(2-methylphenyl)methylsulfonyl]imidazol-4-yl]methyl]-3-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cnc(S(=O)(=O)Cc2ccccc2C)n1Cc1ccccc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C29H28FN3O3S/c1-3-16-32(28(34)24-14-9-15-26(30)17-24)20-27-18-31-29(33(27)19-23-11-5-4-6-12-23)37(35,36)21-25-13-8-7-10-22(25)2/h3-15,17-18H,1,16,19-21H2,2H3 |
| InChIKey | QZFBKBXQGHVUTN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|