C24H25ClFN3O3S — CID 83280762
3-chloro-N-[[2-[(4-fluorophenyl)methylsulfonyl]-3-propan-2-ylimidazol-4-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 83280762) has the molecular formula C24H25ClFN3O3S and a molecular weight of 490.00 g/mol. Its IUPAC name is 3-chloro-N-[[2-[(4-fluorophenyl)methylsulfonyl]-3-propan-2-ylimidazol-4-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-chloro-N-[[2-[(4-fluorophenyl)methylsulfonyl]-3-propan-2-ylimidazol-4-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 83280762 |
| Molecular Formula | C24H25ClFN3O3S |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 3-chloro-N-[[2-[(4-fluorophenyl)methylsulfonyl]-3-propan-2-ylimidazol-4-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cnc(S(=O)(=O)Cc2ccc(F)cc2)n1C(C)C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H25ClFN3O3S/c1-4-12-28(23(30)19-6-5-7-20(25)13-19)15-22-14-27-24(29(22)17(2)3)33(31,32)16-18-8-10-21(26)11-9-18/h4-11,13-14,17H,1,12,15-16H2,2-3H3 |
| InChIKey | CEGOTCQTVDRMOL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|