C24H28N4O7S — CID 42829937
2-methoxyethyl 7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 42829937) has the molecular formula C24H28N4O7S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-methoxyethyl 7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 42829937 |
| Molecular Formula | C24H28N4O7S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-methoxyethyl 7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=C2SC=C(CC(=O)NCC3CCCO3)N2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28N4O7S/c1-15-21(23(30)35-11-10-33-2)22(16-5-7-17(8-6-16)28(31)32)27-18(14-36-24(27)26-15)12-20(29)25-13-19-4-3-9-34-19/h5-8,14,19,22H,3-4,9-13H2,1-2H3,(H,25,29) |
| InChIKey | OQFSSFOPXPDTRV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|