C24H28N4O6S — CID 98357242
propan-2-yl (5S)-7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98357242) has the molecular formula C24H28N4O6S and a molecular weight of 500.58 g/mol. Its IUPAC name is propan-2-yl (5S)-7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl (5S)-7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98357242 |
| Molecular Formula | C24H28N4O6S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | propan-2-yl (5S)-7-methyl-5-(4-nitrophenyl)-3-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@H](c2ccc([N+](=O)[O-])cc2)N2C(CC(=O)NC[C@@H]3CCCO3)=CSC2=N1 |
| InChI | InChI=1S/C24H28N4O6S/c1-14(2)34-23(30)21-15(3)26-24-27(22(21)16-6-8-17(9-7-16)28(31)32)18(13-35-24)11-20(29)25-12-19-5-4-10-33-19/h6-9,13-14,19,22H,4-5,10-12H2,1-3H3,(H,25,29)/t19-,22-/m0/s1 |
| InChIKey | JVSNNIMXFIFLPM-UGKGYDQZSA-N |
| XLogP | 3.81 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|