C22H31N5O2 — CID 42830342
2-(butylamino)-1-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 42830342) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-(butylamino)-1-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(butylamino)-1-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 42830342 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-(butylamino)-1-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CCCCNCC(=O)N1CCCN(c2ccc(-c3cccc(OC)c3)nn2)CC1 |
| InChI | InChI=1S/C22H31N5O2/c1-3-4-11-23-17-22(28)27-13-6-12-26(14-15-27)21-10-9-20(24-25-21)18-7-5-8-19(16-18)29-2/h5,7-10,16,23H,3-4,6,11-15,17H2,1-2H3 |
| InChIKey | JCNAXCDIJGXZQB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|