C24H34N6O2S — CID 42832842
3-ethyl-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-propylthiourea (PubChem CID 42832842) has the molecular formula C24H34N6O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is 3-ethyl-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-propylthiourea.
| Compound Name | 3-ethyl-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-propylthiourea |
|---|---|
| PubChem CID | 42832842 |
| Molecular Formula | C24H34N6O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-ethyl-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-propylthiourea |
| SMILES | CCCN(CC(=O)N1CCCN(c2ccc(-c3cccc(OC)c3)nn2)CC1)C(=S)NCC |
| InChI | InChI=1S/C24H34N6O2S/c1-4-12-30(24(33)25-5-2)18-23(31)29-14-7-13-28(15-16-29)22-11-10-21(26-27-22)19-8-6-9-20(17-19)32-3/h6,8-11,17H,4-5,7,12-16,18H2,1-3H3,(H,25,33) |
| InChIKey | BEEXSFJACNYZSI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|