C24H34N6O3S — CID 46001739
1-(2-methoxyethyl)-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-3-propan-2-ylthiourea (PubChem CID 46001739) has the molecular formula C24H34N6O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-3-propan-2-ylthiourea.
| Compound Name | 1-(2-methoxyethyl)-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 46001739 |
| Molecular Formula | C24H34N6O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-(2-methoxyethyl)-1-[2-[4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-3-propan-2-ylthiourea |
| SMILES | COCCN(CC(=O)N1CCN(c2ccc(-c3cccc(OC)c3)nn2)CC1)C(=S)NC(C)C |
| InChI | InChI=1S/C24H34N6O3S/c1-18(2)25-24(34)30(14-15-32-3)17-23(31)29-12-10-28(11-13-29)22-9-8-21(26-27-22)19-6-5-7-20(16-19)33-4/h5-9,16,18H,10-15,17H2,1-4H3,(H,25,34) |
| InChIKey | UPCAQYIKDHSMES-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|