C23H28N2O4 — CID 42830456
N-ethyl-1-(4-methoxybenzoyl)-4-(3-methoxyphenyl)-N-methylpyrrolidine-3-carboxamide (PubChem CID 42830456) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-ethyl-1-(4-methoxybenzoyl)-4-(3-methoxyphenyl)-N-methylpyrrolidine-3-carboxamide.
| Compound Name | N-ethyl-1-(4-methoxybenzoyl)-4-(3-methoxyphenyl)-N-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42830456 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-ethyl-1-(4-methoxybenzoyl)-4-(3-methoxyphenyl)-N-methylpyrrolidine-3-carboxamide |
| SMILES | CCN(C)C(=O)C1CN(C(=O)c2ccc(OC)cc2)CC1c1cccc(OC)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-5-24(2)23(27)21-15-25(22(26)16-9-11-18(28-3)12-10-16)14-20(21)17-7-6-8-19(13-17)29-4/h6-13,20-21H,5,14-15H2,1-4H3 |
| InChIKey | RMVDXOUPCUPNBD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |