C23H28N2O3 — CID 42680303
1-benzoyl-N,N-diethyl-4-(4-methoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 42680303) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-benzoyl-N,N-diethyl-4-(4-methoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-benzoyl-N,N-diethyl-4-(4-methoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42680303 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-benzoyl-N,N-diethyl-4-(4-methoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CN(C(=O)c2ccccc2)CC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-24(5-2)23(27)21-16-25(22(26)18-9-7-6-8-10-18)15-20(21)17-11-13-19(28-3)14-12-17/h6-14,20-21H,4-5,15-16H2,1-3H3 |
| InChIKey | OOPIHTBYBOPTSM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |