C22H25ClN2O2 — CID 93148612
(3S,4S)-1-(4-chlorobenzoyl)-N,N-diethyl-4-phenylpyrrolidine-3-carboxamide (PubChem CID 93148612) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (3S,4S)-1-(4-chlorobenzoyl)-N,N-diethyl-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-(4-chlorobenzoyl)-N,N-diethyl-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93148612 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3S,4S)-1-(4-chlorobenzoyl)-N,N-diethyl-4-phenylpyrrolidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CN(C(=O)c2ccc(Cl)cc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-3-24(4-2)22(27)20-15-25(14-19(20)16-8-6-5-7-9-16)21(26)17-10-12-18(23)13-11-17/h5-13,19-20H,3-4,14-15H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | KFDISLNDWSUYEE-WOJBJXKFSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |