C20H20N4O2 — CID 4283520
3-(2-ethoxyphenyl)-N'-(1-phenylethenyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 4283520) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N'-(1-phenylethenyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(2-ethoxyphenyl)-N'-(1-phenylethenyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 4283520 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N'-(1-phenylethenyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc(-c2ccccc2OCC)n[nH]1)c1ccccc1 |
| InChI | InChI=1S/C20H20N4O2/c1-3-26-19-12-8-7-11-16(19)17-13-18(23-22-17)20(25)24-21-14(2)15-9-5-4-6-10-15/h4-13,21H,2-3H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | SYMJKYAMDZUXAG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|