C21H23N3O2S — CID 42839493
2-[[cyclopropyl-(2-hydroxy-2-methylbut-3-enyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42839493) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[[cyclopropyl-(2-hydroxy-2-methylbut-3-enyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[cyclopropyl-(2-hydroxy-2-methylbut-3-enyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42839493 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[cyclopropyl-(2-hydroxy-2-methylbut-3-enyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CC(C)(O)CN(Cc1nc2scc(-c3ccccc3)c2c(=O)[nH]1)C1CC1 |
| InChI | InChI=1S/C21H23N3O2S/c1-3-21(2,26)13-24(15-9-10-15)11-17-22-19(25)18-16(12-27-20(18)23-17)14-7-5-4-6-8-14/h3-8,12,15,26H,1,9-11,13H2,2H3,(H,22,23,25) |
| InChIKey | JDQHHYCDTLTCDZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|