C24H31N3O6S — CID 42840026
5-(3,4-dimethoxyphenyl)-2-[[(2-hydroxy-3-prop-2-enoxypropyl)-(2-methoxyethyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42840026) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-[[(2-hydroxy-3-prop-2-enoxypropyl)-(2-methoxyethyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-[[(2-hydroxy-3-prop-2-enoxypropyl)-(2-methoxyethyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42840026 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-[[(2-hydroxy-3-prop-2-enoxypropyl)-(2-methoxyethyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCOCC(O)CN(CCOC)Cc1nc2scc(-c3ccc(OC)c(OC)c3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C24H31N3O6S/c1-5-9-33-14-17(28)12-27(8-10-30-2)13-21-25-23(29)22-18(15-34-24(22)26-21)16-6-7-19(31-3)20(11-16)32-4/h5-7,11,15,17,28H,1,8-10,12-14H2,2-4H3,(H,25,26,29) |
| InChIKey | SRMUBPBFKMPZEQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|