C27H31N3O5 — CID 42840381
N-[2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42840381) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42840381 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-[2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CCNC(=O)C(NC(=O)c1ccc2c(c1)OCO2)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O5/c1-2-14-28-27(33)25(29-26(32)21-9-10-22-23(17-21)35-18-34-22)20-12-15-30(16-13-20)24(31)11-8-19-6-4-3-5-7-19/h2-7,9-10,17,20,25H,1,8,11-16,18H2,(H,28,33)(H,29,32) |
| InChIKey | ZDZBSKMDUQBXNJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|