C25H29N3O3 — CID 42840460
N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]benzamide (PubChem CID 42840460) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]benzamide.
| Compound Name | N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 42840460 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-(prop-2-enylamino)ethyl]benzamide |
| SMILES | C=CCNC(=O)C(NC(=O)c1ccccc1)C1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-15-26-25(31)23(27-24(30)21-11-7-4-8-12-21)20-13-16-28(17-14-20)22(29)18-19-9-5-3-6-10-19/h2-12,20,23H,1,13-18H2,(H,26,31)(H,27,30) |
| InChIKey | ZAYUCHASNCQUQT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|