C26H32FN3O2 — CID 42842361
N-benzyl-2-cyclopentyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-methylacetamide (PubChem CID 42842361) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is N-benzyl-2-cyclopentyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-cyclopentyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 42842361 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-benzyl-2-cyclopentyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H32FN3O2/c1-28(19-20-7-3-2-4-8-20)26(32)24(21-9-5-6-10-21)29-15-17-30(18-16-29)25(31)22-11-13-23(27)14-12-22/h2-4,7-8,11-14,21,24H,5-6,9-10,15-19H2,1H3 |
| InChIKey | VEMMTPHQLYDSFT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |