C22H30F3N3O2 — CID 46024137
2-cyclopentyl-N-ethyl-N-methyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 46024137) has the molecular formula C22H30F3N3O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-cyclopentyl-N-ethyl-N-methyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-ethyl-N-methyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024137 |
| Molecular Formula | C22H30F3N3O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-cyclopentyl-N-ethyl-N-methyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CCN(C)C(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H30F3N3O2/c1-3-26(2)21(30)19(16-6-4-5-7-16)27-12-14-28(15-13-27)20(29)17-8-10-18(11-9-17)22(23,24)25/h8-11,16,19H,3-7,12-15H2,1-2H3 |
| InChIKey | FIVWPQDJQDSTOQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |