C24H36N4O2 — CID 42842428
2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-cyclopentyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 42842428) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-cyclopentyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-cyclopentyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 42842428 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-cyclopentyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | O=C(NCCc1ccccn1)C(C1CCCC1)N1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H36N4O2/c29-23(26-14-12-21-11-5-6-13-25-21)22(19-7-1-2-8-19)27-15-17-28(18-16-27)24(30)20-9-3-4-10-20/h5-6,11,13,19-20,22H,1-4,7-10,12,14-18H2,(H,26,29) |
| InChIKey | NDXFLGQMBIPQFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |