C22H34N4O2 — CID 93209571
(2R)-2-cyclopentyl-2-[4-(3-methylbutanoyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 93209571) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-[4-(3-methylbutanoyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | (2R)-2-cyclopentyl-2-[4-(3-methylbutanoyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 93209571 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2R)-2-cyclopentyl-2-[4-(3-methylbutanoyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC(C)CC(=O)N1CCN([C@@H](C(=O)NCc2ccccn2)C2CCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-17(2)15-20(27)25-11-13-26(14-12-25)21(18-7-3-4-8-18)22(28)24-16-19-9-5-6-10-23-19/h5-6,9-10,17-18,21H,3-4,7-8,11-16H2,1-2H3,(H,24,28)/t21-/m1/s1 |
| InChIKey | CGDDWYNQJVQTRS-OAQYLSRUSA-N |
| XLogP | 2.45 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |