C22H31F2N3O3 — CID 42842571
2-cyclopentyl-2-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 42842571) has the molecular formula C22H31F2N3O3 and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 42842571 |
| Molecular Formula | C22H31F2N3O3 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-cyclopentyl-2-[4-(3,5-difluorobenzoyl)piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C22H31F2N3O3/c1-30-12-4-7-25-21(28)20(16-5-2-3-6-16)26-8-10-27(11-9-26)22(29)17-13-18(23)15-19(24)14-17/h13-16,20H,2-12H2,1H3,(H,25,28) |
| InChIKey | PKMNFHAXKCXBSA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|