C27H41FN4O2 — CID 46024838
2-cyclopentyl-2-[4-(3-fluorobenzoyl)piperazin-1-yl]-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 46024838) has the molecular formula C27H41FN4O2 and a molecular weight of 472.65 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(3-fluorobenzoyl)piperazin-1-yl]-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(3-fluorobenzoyl)piperazin-1-yl]-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 46024838 |
| Molecular Formula | C27H41FN4O2 |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 2-cyclopentyl-2-[4-(3-fluorobenzoyl)piperazin-1-yl]-N-[3-(2-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC1CCCCN1CCCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C27H41FN4O2/c1-21-8-4-5-14-30(21)15-7-13-29-26(33)25(22-9-2-3-10-22)31-16-18-32(19-17-31)27(34)23-11-6-12-24(28)20-23/h6,11-12,20-22,25H,2-5,7-10,13-19H2,1H3,(H,29,33) |
| InChIKey | BKIXRZUYWAJKFU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|