C23H35ClN4O2 — CID 42842805
2-[4-(3-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 42842805) has the molecular formula C23H35ClN4O2 and a molecular weight of 435.01 g/mol. Its IUPAC name is 2-[4-(3-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[4-(3-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 42842805 |
| Molecular Formula | C23H35ClN4O2 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[4-(3-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H35ClN4O2/c1-26(2)12-6-11-25-22(29)21(18-7-3-4-8-18)27-13-15-28(16-14-27)23(30)19-9-5-10-20(24)17-19/h5,9-10,17-18,21H,3-4,6-8,11-16H2,1-2H3,(H,25,29) |
| InChIKey | HXXHUEYCTPNXQG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|