C28H31N3O2 — CID 42843264
2-[(3-methyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]-1-phenylethanol (PubChem CID 42843264) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-[(3-methyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]-1-phenylethanol.
| Compound Name | 2-[(3-methyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 42843264 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-[(3-methyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]-1-phenylethanol |
| SMILES | CCCN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccccc1)CC(O)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O2/c1-3-19-30(21-27(32)23-13-7-4-8-14-23)20-26-22(2)29-31(24-15-9-5-10-16-24)28(26)33-25-17-11-6-12-18-25/h4-18,27,32H,3,19-21H2,1-2H3 |
| InChIKey | DUVLCCJIMUDBSB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |