C22H33FN4OS — CID 42843543
2-cyclopentyl-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 42843543) has the molecular formula C22H33FN4OS and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-cyclopentyl-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 42843543 |
| Molecular Formula | C22H33FN4OS |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-cyclopentyl-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)C(C1CCCC1)N1CCN(C(=S)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H33FN4OS/c1-16(2)15-24-21(28)20(17-5-3-4-6-17)26-11-13-27(14-12-26)22(29)25-19-9-7-18(23)8-10-19/h7-10,16-17,20H,3-6,11-15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | GFUKEGRYTPMAMY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|