C28H37N3O2 — CID 46024214
2-cyclopentyl-N-(2-methylpropyl)-2-[4-(4-phenylbenzoyl)piperazin-1-yl]acetamide (PubChem CID 46024214) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 2-cyclopentyl-N-(2-methylpropyl)-2-[4-(4-phenylbenzoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-(2-methylpropyl)-2-[4-(4-phenylbenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024214 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 2-cyclopentyl-N-(2-methylpropyl)-2-[4-(4-phenylbenzoyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)CNC(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H37N3O2/c1-21(2)20-29-27(32)26(24-10-6-7-11-24)30-16-18-31(19-17-30)28(33)25-14-12-23(13-15-25)22-8-4-3-5-9-22/h3-5,8-9,12-15,21,24,26H,6-7,10-11,16-20H2,1-2H3,(H,29,32) |
| InChIKey | OLZRVNFXVLSDCJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |